C29H36FN11O3 — CID 146468081
2-amino-N-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl]-3-methylbutanamide (PubChem CID 146468081) has the molecular formula C29H36FN11O3 and a molecular weight of 605.68 g/mol. Its IUPAC name is 2-amino-N-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 146468081 |
| Molecular Formula | C29H36FN11O3 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | 2-amino-N-[2-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethyl]-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)NCCOc1ccc(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)c(F)c1 |
| InChI | InChI=1S/C29H36FN11O3/c1-18(2)24(31)28(42)33-7-15-43-19-5-6-22(21(30)16-19)39-11-8-38(9-12-39)10-13-40-26-20(17-34-40)27-35-25(23-4-3-14-44-23)37-41(27)29(32)36-26/h3-6,14,16-18,24H,7-13,15,31H2,1-2H3,(H2,32,36)(H,33,42) |
| InChIKey | VEWUWUYXZRFSSD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 170.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|