C26H29FN8O4S — CID 146468464
5-[2-[4-[2-fluoro-4-(2-methylsulfonylethoxy)phenyl]piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine (PubChem CID 146468464) has the molecular formula C26H29FN8O4S and a molecular weight of 568.64 g/mol. Its IUPAC name is 5-[2-[4-[2-fluoro-4-(2-methylsulfonylethoxy)phenyl]piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine.
| Compound Name | 5-[2-[4-[2-fluoro-4-(2-methylsulfonylethoxy)phenyl]piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 146468464 |
| Molecular Formula | C26H29FN8O4S |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 5-[2-[4-[2-fluoro-4-(2-methylsulfonylethoxy)phenyl]piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine |
| SMILES | CS(=O)(=O)CCOc1ccc(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)cc43)CC2)c(F)c1 |
| InChI | InChI=1S/C26H29FN8O4S/c1-40(36,37)14-13-38-18-4-5-22(20(27)15-18)33-9-6-32(7-10-33)8-11-34-25-19(17-29-34)23-16-21(24-3-2-12-39-24)31-35(23)26(28)30-25/h2-5,12,15-17H,6-11,13-14H2,1H3,(H2,28,30) |
| InChIKey | FVHGEUZQZSAIGX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|