C18H16N2O6S — CID 146469234
(2R)-1-(4-nitrophenyl)sulfonyl-2-phenyl-3,6-dihydro-2H-pyridine-5-carboxylic acid (PubChem CID 146469234) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is (2R)-1-(4-nitrophenyl)sulfonyl-2-phenyl-3,6-dihydro-2H-pyridine-5-carboxylic acid.
| Compound Name | (2R)-1-(4-nitrophenyl)sulfonyl-2-phenyl-3,6-dihydro-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 146469234 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (2R)-1-(4-nitrophenyl)sulfonyl-2-phenyl-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| SMILES | O=C(O)C1=CC[C@H](c2ccccc2)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H16N2O6S/c21-18(22)14-6-11-17(13-4-2-1-3-5-13)19(12-14)27(25,26)16-9-7-15(8-10-16)20(23)24/h1-10,17H,11-12H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | LSUPRFCSQYKIPK-QGZVFWFLSA-N |
| XLogP | 2.74 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|