About 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide
2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide (PubChem CID 146469708) has the molecular formula C24H25FN2O
and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide.
Molecular Properties
| Compound Name | 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide |
| PubChem CID | 146469708 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide |
| SMILES | C=C(C)CC(C)(Cc1ccccc1)C(=O)Nc1cc2cccc(F)c2nc1C |
| InChI | InChI=1S/C24H25FN2O/c1-16(2)14-24(4,15-18-9-6-5-7-10-18)23(28)27-21-13-19-11-8-12-20(25)22(19)26-17(21)3/h5-13H,1,14-15H2,2-4H3,(H,27,28) |
| InChIKey | SCLJPVVMYACNRD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide?
The IUPAC name of 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide (CID 146469708) is 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide.
What is the SMILES notation for 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide?
The canonical SMILES for 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide is C=C(C)CC(C)(Cc1ccccc1)C(=O)Nc1cc2cccc(F)c2nc1C.
What is the InChIKey of 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide?
The InChIKey is SCLJPVVMYACNRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25FN2O/c1-16(2)14-24(4,15-18-9-6-5-7-10-18)23(28)27-21-13-19-11-8-12-20(25)22(19)26-17(21)3/h5-13H,1,14-15H2,2-4H3,(H,27,28).
What are the key properties of 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide?
2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide has a molecular weight of 376.48 g/mol, XLogP of 5.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide is sourced from PubChem (CID 146469708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).