About 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine
6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine (PubChem CID 146469926) has the molecular formula C19H21N5O
and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine.
Molecular Properties
| Compound Name | 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine |
| PubChem CID | 146469926 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine |
| SMILES | CCc1ccncc1-c1cc(N)c2nnc(NC3CCOC3)cc2c1 |
| InChI | InChI=1S/C19H21N5O/c1-2-12-3-5-21-10-16(12)13-7-14-9-18(22-15-4-6-25-11-15)23-24-19(14)17(20)8-13/h3,5,7-10,15H,2,4,6,11,20H2,1H3,(H,22,23) |
| InChIKey | FKDILQSQZRKLRH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine?
The IUPAC name of 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine (CID 146469926) is 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine.
What is the SMILES notation for 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine?
The canonical SMILES for 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine is CCc1ccncc1-c1cc(N)c2nnc(NC3CCOC3)cc2c1.
What is the InChIKey of 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine?
The InChIKey is FKDILQSQZRKLRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O/c1-2-12-3-5-21-10-16(12)13-7-14-9-18(22-15-4-6-25-11-15)23-24-19(14)17(20)8-13/h3,5,7-10,15H,2,4,6,11,20H2,1H3,(H,22,23).
What are the key properties of 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine?
6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine has a molecular weight of 335.41 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-ethyl-3-pyridinyl)-3-N-(oxolan-3-yl)cinnoline-3,8-diamine is sourced from PubChem (CID 146469926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).