C14H21F3N4O4 — CID 146470194
2-methyl-1-[4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidin-1-yl]propan-2-ol (PubChem CID 146470194) has the molecular formula C14H21F3N4O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-methyl-1-[4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidin-1-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 146470194 |
| Molecular Formula | C14H21F3N4O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-methyl-1-[4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]piperidin-1-yl]propan-2-ol |
| SMILES | CC(C)(O)CN1CCC(n2cc([N+](=O)[O-])c(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H21F3N4O4/c1-13(2,22)8-19-5-3-10(4-6-19)20-7-11(21(23)24)12(18-20)25-9-14(15,16)17/h7,10,22H,3-6,8-9H2,1-2H3 |
| InChIKey | GRNMWQQUMDIXJO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|