C16H15ClF2N4O — CID 146470274
3-[chloro(difluoro)methyl]-6-(2-methyl-4-propan-2-yloxyphenyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 146470274) has the molecular formula C16H15ClF2N4O and a molecular weight of 352.77 g/mol. Its IUPAC name is 3-[chloro(difluoro)methyl]-6-(2-methyl-4-propan-2-yloxyphenyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[chloro(difluoro)methyl]-6-(2-methyl-4-propan-2-yloxyphenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 146470274 |
| Molecular Formula | C16H15ClF2N4O |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-[chloro(difluoro)methyl]-6-(2-methyl-4-propan-2-yloxyphenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Cc1cc(OC(C)C)ccc1-c1cn2c(C(F)(F)Cl)nnc2cn1 |
| InChI | InChI=1S/C16H15ClF2N4O/c1-9(2)24-11-4-5-12(10(3)6-11)13-8-23-14(7-20-13)21-22-15(23)16(17,18)19/h4-9H,1-3H3 |
| InChIKey | UOLZPYPGMYKLGC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|