About 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid
4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid (PubChem CID 146471630) has the molecular formula C10H18F2N2O2
and a molecular weight of 236.26 g/mol. Its IUPAC name is 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid.
Molecular Properties
| Compound Name | 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid |
| PubChem CID | 146471630 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid |
| SMILES | CNC(CCN1CCCC(F)(F)C1)C(=O)O |
| InChI | InChI=1S/C10H18F2N2O2/c1-13-8(9(15)16)3-6-14-5-2-4-10(11,12)7-14/h8,13H,2-7H2,1H3,(H,15,16) |
| InChIKey | ZPOHXCPBNCLRLM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid?
The IUPAC name of 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid (CID 146471630) is 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid.
What is the SMILES notation for 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid?
The canonical SMILES for 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid is CNC(CCN1CCCC(F)(F)C1)C(=O)O.
What is the InChIKey of 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid?
The InChIKey is ZPOHXCPBNCLRLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O2/c1-13-8(9(15)16)3-6-14-5-2-4-10(11,12)7-14/h8,13H,2-7H2,1H3,(H,15,16).
What are the key properties of 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid?
4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid has a molecular weight of 236.26 g/mol, XLogP of 0.78, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid is sourced from PubChem (CID 146471630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).