C11H15F4NO4 — CID 146471753
2-(pent-4-enoylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid (PubChem CID 146471753) has the molecular formula C11H15F4NO4 and a molecular weight of 301.24 g/mol. Its IUPAC name is 2-(pent-4-enoylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid.
| Compound Name | 2-(pent-4-enoylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid |
|---|---|
| PubChem CID | 146471753 |
| Molecular Formula | C11H15F4NO4 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(pent-4-enoylamino)-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid |
| SMILES | C=CCCC(=O)NC(COCC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C11H15F4NO4/c1-2-3-4-8(17)16-7(9(18)19)5-20-6-11(14,15)10(12)13/h2,7,10H,1,3-6H2,(H,16,17)(H,18,19) |
| InChIKey | PJMFKURQFANZMS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|