About 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid
2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid (PubChem CID 146471778) has the molecular formula C9H16F2N2O2
and a molecular weight of 222.23 g/mol. Its IUPAC name is 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid |
| PubChem CID | 146471778 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid |
| SMILES | O=C(O)CNCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H16F2N2O2/c10-9(11)1-4-13(5-2-9)6-3-12-7-8(14)15/h12H,1-7H2,(H,14,15) |
| InChIKey | WIOYXLKWIWVETI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid?
The IUPAC name of 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid (CID 146471778) is 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid.
What is the SMILES notation for 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid?
The canonical SMILES for 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid is O=C(O)CNCCN1CCC(F)(F)CC1.
What is the InChIKey of 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid?
The InChIKey is WIOYXLKWIWVETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O2/c10-9(11)1-4-13(5-2-9)6-3-12-7-8(14)15/h12H,1-7H2,(H,14,15).
What are the key properties of 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid?
2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid has a molecular weight of 222.23 g/mol, XLogP of 0.39, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,4-difluoropiperidin-1-yl)ethylamino]acetic acid is sourced from PubChem (CID 146471778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).