About (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide
(2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide (PubChem CID 146471848) has the molecular formula C10H19BrF2N2O2
and a molecular weight of 317.17 g/mol. Its IUPAC name is (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide.
Molecular Properties
| Compound Name | (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide |
| PubChem CID | 146471848 |
| Molecular Formula | C10H19BrF2N2O2 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide |
| SMILES | Br.CN[C@@H](CCN1CCCC(F)(F)C1)C(=O)O |
| InChI | InChI=1S/C10H18F2N2O2.BrH/c1-13-8(9(15)16)3-6-14-5-2-4-10(11,12)7-14;/h8,13H,2-7H2,1H3,(H,15,16);1H/t8-;/m0./s1 |
| InChIKey | CMOWXTZSNXIUCH-QRPNPIFTSA-N |
| XLogP | 1.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide?
The IUPAC name of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide (CID 146471848) is (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide.
What is the SMILES notation for (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide?
The canonical SMILES for (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide is Br.CN[C@@H](CCN1CCCC(F)(F)C1)C(=O)O.
What is the InChIKey of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide?
The InChIKey is CMOWXTZSNXIUCH-QRPNPIFTSA-N. The full InChI is InChI=1S/C10H18F2N2O2.BrH/c1-13-8(9(15)16)3-6-14-5-2-4-10(11,12)7-14;/h8,13H,2-7H2,1H3,(H,15,16);1H/t8-;/m0./s1.
What are the key properties of (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide?
(2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide has a molecular weight of 317.17 g/mol, XLogP of 1.36, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(3,3-difluoropiperidin-1-yl)-2-(methylamino)butanoic acid;hydrobromide is sourced from PubChem (CID 146471848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).