C18H20ClF3N4O4S2 — CID 146472105
[[5-chloro-4-[[(1R,2R)-2-(dimethylamino)-4,4-difluorocyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate (PubChem CID 146472105) has the molecular formula C18H20ClF3N4O4S2 and a molecular weight of 512.96 g/mol. Its IUPAC name is [[5-chloro-4-[[(1R,2R)-2-(dimethylamino)-4,4-difluorocyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate.
| Compound Name | [[5-chloro-4-[[(1R,2R)-2-(dimethylamino)-4,4-difluorocyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate |
|---|---|
| PubChem CID | 146472105 |
| Molecular Formula | C18H20ClF3N4O4S2 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | [[5-chloro-4-[[(1R,2R)-2-(dimethylamino)-4,4-difluorocyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate |
| SMILES | CN(C)[C@@H]1CC(F)(F)CC[C@H]1Nc1cc(F)c(S(=O)(=O)N(OC=O)c2nccs2)cc1Cl |
| InChI | InChI=1S/C18H20ClF3N4O4S2/c1-25(2)15-9-18(21,22)4-3-13(15)24-14-8-12(20)16(7-11(14)19)32(28,29)26(30-10-27)17-23-5-6-31-17/h5-8,10,13,15,24H,3-4,9H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | WEWCUYXZEZMEQI-UKRRQHHQSA-N |
| XLogP | 3.75 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|