C21H26ClFN4O4S2 — CID 146472161
[[5-chloro-4-[[(1S,2S)-2-[cyclobutyl(methyl)amino]cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate (PubChem CID 146472161) has the molecular formula C21H26ClFN4O4S2 and a molecular weight of 517.05 g/mol. Its IUPAC name is [[5-chloro-4-[[(1S,2S)-2-[cyclobutyl(methyl)amino]cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate.
| Compound Name | [[5-chloro-4-[[(1S,2S)-2-[cyclobutyl(methyl)amino]cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate |
|---|---|
| PubChem CID | 146472161 |
| Molecular Formula | C21H26ClFN4O4S2 |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | [[5-chloro-4-[[(1S,2S)-2-[cyclobutyl(methyl)amino]cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate |
| SMILES | CN(C1CCC1)[C@H]1CCCC[C@@H]1Nc1cc(F)c(S(=O)(=O)N(OC=O)c2nccs2)cc1Cl |
| InChI | InChI=1S/C21H26ClFN4O4S2/c1-26(14-5-4-6-14)19-8-3-2-7-17(19)25-18-12-16(23)20(11-15(18)22)33(29,30)27(31-13-28)21-24-9-10-32-21/h9-14,17,19,25H,2-8H2,1H3/t17-,19-/m0/s1 |
| InChIKey | DVVPLSBZBWRZMJ-HKUYNNGSSA-N |
| XLogP | 4.43 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|