C18H22BrFN4O4S2 — CID 146472197
[[5-bromo-4-[[(1S,2S)-2-(ethylamino)cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate (PubChem CID 146472197) has the molecular formula C18H22BrFN4O4S2 and a molecular weight of 521.43 g/mol. Its IUPAC name is [[5-bromo-4-[[(1S,2S)-2-(ethylamino)cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate.
| Compound Name | [[5-bromo-4-[[(1S,2S)-2-(ethylamino)cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate |
|---|---|
| PubChem CID | 146472197 |
| Molecular Formula | C18H22BrFN4O4S2 |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | [[5-bromo-4-[[(1S,2S)-2-(ethylamino)cyclohexyl]amino]-2-fluorophenyl]sulfonyl-(1,3-thiazol-2-yl)amino] formate |
| SMILES | CCN[C@H]1CCCC[C@@H]1Nc1cc(F)c(S(=O)(=O)N(OC=O)c2nccs2)cc1Br |
| InChI | InChI=1S/C18H22BrFN4O4S2/c1-2-21-14-5-3-4-6-15(14)23-16-10-13(20)17(9-12(16)19)30(26,27)24(28-11-25)18-22-7-8-29-18/h7-11,14-15,21,23H,2-6H2,1H3/t14-,15-/m0/s1 |
| InChIKey | HYHRMXFLJUEQBI-GJZGRUSLSA-N |
| XLogP | 3.66 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|