About (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate
(5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate (PubChem CID 146472626) has the molecular formula C10H11NO7S
and a molecular weight of 289.26 g/mol. Its IUPAC name is (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate |
| PubChem CID | 146472626 |
| Molecular Formula | C10H11NO7S |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1COc2cccc([N+](=O)[O-])c2O1 |
| InChI | InChI=1S/C10H11NO7S/c1-19(14,15)17-6-7-5-16-9-4-2-3-8(11(12)13)10(9)18-7/h2-4,7H,5-6H2,1H3 |
| InChIKey | UVBJXRAPJOPSJL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate?
The IUPAC name of (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate (CID 146472626) is (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate.
What is the SMILES notation for (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate?
The canonical SMILES for (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate is CS(=O)(=O)OCC1COc2cccc([N+](=O)[O-])c2O1.
What is the InChIKey of (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate?
The InChIKey is UVBJXRAPJOPSJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO7S/c1-19(14,15)17-6-7-5-16-9-4-2-3-8(11(12)13)10(9)18-7/h2-4,7H,5-6H2,1H3.
What are the key properties of (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate?
(5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate has a molecular weight of 289.26 g/mol, XLogP of 0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl methanesulfonate is sourced from PubChem (CID 146472626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).