C20H28N2O4 — CID 146472717
2-[3-(2-amino-2-oxoethoxy)-4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenoxy]acetamide (PubChem CID 146472717) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[3-(2-amino-2-oxoethoxy)-4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenoxy]acetamide.
| Compound Name | 2-[3-(2-amino-2-oxoethoxy)-4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 146472717 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[3-(2-amino-2-oxoethoxy)-4-[(1E)-3,7-dimethylocta-1,6-dienyl]phenoxy]acetamide |
| SMILES | CC(C)=CCCC(C)/C=C/c1ccc(OCC(N)=O)cc1OCC(N)=O |
| InChI | InChI=1S/C20H28N2O4/c1-14(2)5-4-6-15(3)7-8-16-9-10-17(25-12-19(21)23)11-18(16)26-13-20(22)24/h5,7-11,15H,4,6,12-13H2,1-3H3,(H2,21,23)(H2,22,24)/b8-7+ |
| InChIKey | SBSBASPANQBEOH-BQYQJAHWSA-N |
| XLogP | 2.81 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|