C18H24F3N4O8PS — CID 146472923
[(2S,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(trifluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 146472923) has the molecular formula C18H24F3N4O8PS and a molecular weight of 544.45 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(trifluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(trifluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 146472923 |
| Molecular Formula | C18H24F3N4O8PS |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[4-(cyclopentylamino)-2-(trifluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)C[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)nc(C(F)(F)F)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H24F3N4O8PS/c19-18(20,21)17-23-14(22-9-3-1-2-4-9)10-5-6-25(15(10)24-17)16-13(27)12(26)11(33-16)7-35(31,32)8-34(28,29)30/h5-6,9,11-13,16,26-27H,1-4,7-8H2,(H,22,23,24)(H2,28,29,30)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | WHLNVTBCNWBRJE-BRXULGCHSA-N |
| XLogP | 0.97 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|