C20H22ClF2N4O8PS — CID 146473126
[(2S,3S,4R,5R)-5-[2-chloro-4-[1-(2,4-difluorophenyl)ethylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 146473126) has the molecular formula C20H22ClF2N4O8PS and a molecular weight of 582.91 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[2-chloro-4-[1-(2,4-difluorophenyl)ethylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[2-chloro-4-[1-(2,4-difluorophenyl)ethylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 146473126 |
| Molecular Formula | C20H22ClF2N4O8PS |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[2-chloro-4-[1-(2,4-difluorophenyl)ethylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | CC(Nc1nc(Cl)nc2c1ccn2[C@@H]1O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H22ClF2N4O8PS/c1-9(11-3-2-10(22)6-13(11)23)24-17-12-4-5-27(18(12)26-20(21)25-17)19-16(29)15(28)14(35-19)7-37(33,34)8-36(30,31)32/h2-6,9,14-16,19,28-29H,7-8H2,1H3,(H,24,25,26)(H2,30,31,32)/t9?,14-,15-,16-,19-/m1/s1 |
| InChIKey | ZOECCVNSQQKTMJ-AEVNISMDSA-N |
| XLogP | 1.71 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|