C22H23F3N5O7P — CID 146473233
[(2R,3S,4R,5R)-5-[2-cyano-4-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146473233) has the molecular formula C22H23F3N5O7P and a molecular weight of 557.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-cyano-4-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-cyano-4-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146473233 |
| Molecular Formula | C22H23F3N5O7P |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-cyano-4-[[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | C[C@@H](Nc1nc(C#N)nc2c1ccn2[C@@H]1O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H23F3N5O7P/c1-11(12-2-4-13(5-3-12)22(23,24)25)27-19-14-6-7-30(20(14)29-16(8-26)28-19)21-18(32)17(31)15(37-21)9-36-10-38(33,34)35/h2-7,11,15,17-18,21,31-32H,9-10H2,1H3,(H,27,28,29)(H2,33,34,35)/t11-,15-,17-,18-,21-/m1/s1 |
| InChIKey | PSJZXWISYHDNCN-FLGHAZAGSA-N |
| XLogP | 2.27 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|