fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid

C2H6F2O4P2 — CID 146473345

IUPACfluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid
SMILESOP(F)OCCOP(O)F
InChIInChI=1S/C2H6F2O4P2/c3-9(5)7-1-2-8-10(4)6/h5-6H,1-2H2
InChIKeyPVYGIFONJFLSAR-UHFFFAOYSA-N
MW194.01 g/mol
LogP1.40
Rot. Bonds5

About fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid

fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid (PubChem CID 146473345) has the molecular formula C2H6F2O4P2 and a molecular weight of 194.01 g/mol. Its IUPAC name is fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid.

Molecular Properties

Compound Namefluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid
PubChem CID146473345
Molecular FormulaC2H6F2O4P2
Molecular Weight194.01 g/mol
Exact Mass193.97
IUPAC Namefluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid
SMILESOP(F)OCCOP(O)F
InChIInChI=1S/C2H6F2O4P2/c3-9(5)7-1-2-8-10(4)6/h5-6H,1-2H2
InChIKeyPVYGIFONJFLSAR-UHFFFAOYSA-N
XLogP1.40
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.01
LogP ≤ 51.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid?
The IUPAC name of fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid (CID 146473345) is fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid.
What is the SMILES notation for fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid?
The canonical SMILES for fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid is OP(F)OCCOP(O)F.
What is the InChIKey of fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid?
The InChIKey is PVYGIFONJFLSAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6F2O4P2/c3-9(5)7-1-2-8-10(4)6/h5-6H,1-2H2.
What are the key properties of fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid?
fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid has a molecular weight of 194.01 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro-[2-[fluoro(hydroxy)phosphanyl]oxyethoxy]phosphinous acid is sourced from PubChem (CID 146473345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).