C22H18N2O4 — CID 146473406
11-benzyl-4-(4-hydroxyphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 146473406) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 11-benzyl-4-(4-hydroxyphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 11-benzyl-4-(4-hydroxyphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 146473406 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 11-benzyl-4-(4-hydroxyphenyl)-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | O=C1C=CC2C3C(=O)N(c4ccc(O)cc4)C(=O)C3C1N2Cc1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c25-15-8-6-14(7-9-15)24-21(27)18-16-10-11-17(26)20(19(18)22(24)28)23(16)12-13-4-2-1-3-5-13/h1-11,16,18-20,25H,12H2 |
| InChIKey | BDKRRMKQNPLYPX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|