C22H20Cl2N4O3 — CID 146474745
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-(5-methyl-1H-pyrazol-4-yl)-1,6-naphthyridin-2-one (PubChem CID 146474745) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-(5-methyl-1H-pyrazol-4-yl)-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-(5-methyl-1H-pyrazol-4-yl)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 146474745 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-(5-methyl-1H-pyrazol-4-yl)-1,6-naphthyridin-2-one |
| SMILES | CCn1c(=O)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(-c3cn[nH]c3C)cc21 |
| InChI | InChI=1S/C22H20Cl2N4O3/c1-5-28-16-7-15(14-10-26-27-11(14)2)25-9-12(16)6-13(22(28)29)19-20(23)17(30-3)8-18(31-4)21(19)24/h6-10H,5H2,1-4H3,(H,26,27) |
| InChIKey | YIOWQZVQYIQACQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|