C19H15Cl3N2O4 — CID 146474786
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(oxetan-3-yl)-1,6-naphthyridin-2-one (PubChem CID 146474786) has the molecular formula C19H15Cl3N2O4 and a molecular weight of 441.70 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(oxetan-3-yl)-1,6-naphthyridin-2-one.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(oxetan-3-yl)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 146474786 |
| Molecular Formula | C19H15Cl3N2O4 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(oxetan-3-yl)-1,6-naphthyridin-2-one |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3n(C3COC3)c2=O)c1Cl |
| InChI | InChI=1S/C19H15Cl3N2O4/c1-26-13-5-14(27-2)18(22)16(17(13)21)11-3-9-6-23-15(20)4-12(9)24(19(11)25)10-7-28-8-10/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | RPAJVMHYBCKBCT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|