About (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal
(Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal (PubChem CID 146475227) has the molecular formula C15H29N3O2
and a molecular weight of 283.42 g/mol. Its IUPAC name is (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal.
Molecular Properties
| Compound Name | (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal |
| PubChem CID | 146475227 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal |
| SMILES | CNCCN/C(C(C)=O)=C(/C=O)NCCCC(C)(C)C |
| InChI | InChI=1S/C15H29N3O2/c1-12(20)14(18-10-9-16-5)13(11-19)17-8-6-7-15(2,3)4/h11,16-18H,6-10H2,1-5H3/b14-13- |
| InChIKey | GCQDJAYCPBTACO-YPKPFQOOSA-N |
| XLogP | 1.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal?
The IUPAC name of (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal (CID 146475227) is (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal.
What is the SMILES notation for (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal?
The canonical SMILES for (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal is CNCCN/C(C(C)=O)=C(/C=O)NCCCC(C)(C)C.
What is the InChIKey of (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal?
The InChIKey is GCQDJAYCPBTACO-YPKPFQOOSA-N. The full InChI is InChI=1S/C15H29N3O2/c1-12(20)14(18-10-9-16-5)13(11-19)17-8-6-7-15(2,3)4/h11,16-18H,6-10H2,1-5H3/b14-13-.
What are the key properties of (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal?
(Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal has a molecular weight of 283.42 g/mol, XLogP of 1.21, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(4,4-dimethylpentylamino)-3-[2-(methylamino)ethylamino]-4-oxopent-2-enal is sourced from PubChem (CID 146475227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).