C23H15F3N8O — CID 146476014
5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-N-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 146476014) has the molecular formula C23H15F3N8O and a molecular weight of 476.42 g/mol. Its IUPAC name is 5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-N-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-N-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146476014 |
| Molecular Formula | C23H15F3N8O |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-N-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C/C=N\Nc1cc(NC(=O)c2cncc(C#Cc3cnc4cccnn34)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15F3N8O/c24-23(25,26)17-9-18(11-19(10-17)33-30-7-5-27)32-22(35)16-8-15(12-28-13-16)3-4-20-14-29-21-2-1-6-31-34(20)21/h1-2,5-14,27,33H,(H,32,35)/b27-5+,30-7- |
| InChIKey | QPQXKVJJNLPIAH-SOFHZBEGSA-N |
| XLogP | 3.84 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|