About 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine
9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine (PubChem CID 146476136) has the molecular formula C10H11BrN2
and a molecular weight of 239.12 g/mol. Its IUPAC name is 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine.
Molecular Properties
| Compound Name | 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine |
| PubChem CID | 146476136 |
| Molecular Formula | C10H11BrN2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine |
| SMILES | CC1C=C(Br)N2N=CC=CC2=CC1 |
| InChI | InChI=1S/C10H11BrN2/c1-8-4-5-9-3-2-6-12-13(9)10(11)7-8/h2-3,5-8H,4H2,1H3 |
| InChIKey | FZYKBPXGWWCXFE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
The IUPAC name of 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine (CID 146476136) is 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine.
What is the SMILES notation for 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
The canonical SMILES for 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine is CC1C=C(Br)N2N=CC=CC2=CC1.
What is the InChIKey of 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
The InChIKey is FZYKBPXGWWCXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2/c1-8-4-5-9-3-2-6-12-13(9)10(11)7-8/h2-3,5-8H,4H2,1H3.
What are the key properties of 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine has a molecular weight of 239.12 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-7-methyl-6,7-dihydropyridazino[1,6-a]azepine is sourced from PubChem (CID 146476136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).