C21H21F4N3O3 — CID 146476401
N-(4-fluoro-3-methylphenyl)-3-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 146476401) has the molecular formula C21H21F4N3O3 and a molecular weight of 439.41 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-3-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-3-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 146476401 |
| Molecular Formula | C21H21F4N3O3 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-3-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(C(=O)C(=O)N[C@@H](C)C(F)(F)F)n3c2CCCC3)ccc1F |
| InChI | InChI=1S/C21H21F4N3O3/c1-11-9-13(6-7-15(11)22)27-19(30)14-10-17(28-8-4-3-5-16(14)28)18(29)20(31)26-12(2)21(23,24)25/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,26,31)(H,27,30)/t12-/m0/s1 |
| InChIKey | JFZIJYSOWGFXMU-LBPRGKRZSA-N |
| XLogP | 3.77 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|