C22H22FN5O4 — CID 146476442
N-(4-fluoro-3-methylphenyl)-3-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 146476442) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-3-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-3-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 146476442 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-3-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | Cc1noc(CNC(=O)C(=O)c2cc(C(=O)Nc3ccc(F)c(C)c3)c3n2CCCC3)n1 |
| InChI | InChI=1S/C22H22FN5O4/c1-12-9-14(6-7-16(12)23)26-21(30)15-10-18(28-8-4-3-5-17(15)28)20(29)22(31)24-11-19-25-13(2)27-32-19/h6-7,9-10H,3-5,8,11H2,1-2H3,(H,24,31)(H,26,30) |
| InChIKey | YHEVOCSPDBGPIL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|