C24H33N5O9S — CID 146477309
3-[4-(oxiran-2-ylmethoxymethyl)triazol-1-yl]propyl 3-(acetyloxymethyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 146477309) has the molecular formula C24H33N5O9S and a molecular weight of 567.62 g/mol. Its IUPAC name is 3-[4-(oxiran-2-ylmethoxymethyl)triazol-1-yl]propyl 3-(acetyloxymethyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 3-[4-(oxiran-2-ylmethoxymethyl)triazol-1-yl]propyl 3-(acetyloxymethyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 146477309 |
| Molecular Formula | C24H33N5O9S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 3-[4-(oxiran-2-ylmethoxymethyl)triazol-1-yl]propyl 3-(acetyloxymethyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OCCCn2cc(COCC3CO3)nn2)N2C(=O)C(NC(=O)OC(C)(C)C)C2SC1 |
| InChI | InChI=1S/C24H33N5O9S/c1-14(30)36-9-15-13-39-21-18(25-23(33)38-24(2,3)4)20(31)29(21)19(15)22(32)35-7-5-6-28-8-16(26-27-28)10-34-11-17-12-37-17/h8,17-18,21H,5-7,9-13H2,1-4H3,(H,25,33) |
| InChIKey | OHKYQJFSCNTQIO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|