C30H36N6O4S — CID 146477473
[6-[[4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]-3-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazin-2-yl]methanol (PubChem CID 146477473) has the molecular formula C30H36N6O4S and a molecular weight of 576.72 g/mol. Its IUPAC name is [6-[[4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]-3-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazin-2-yl]methanol.
| Compound Name | [6-[[4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]-3-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 146477473 |
| Molecular Formula | C30H36N6O4S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | [6-[[4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]-3-spiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-1'-ylpyrazin-2-yl]methanol |
| SMILES | COCOCC1CC2COc3c(Sc4cnc(N5CCC6(CC5)Cc5cccnc5C6)c(CO)n4)ccnc3N2C1 |
| InChI | InChI=1S/C30H36N6O4S/c1-38-19-39-17-20-11-22-18-40-27-25(4-8-32-29(27)36(22)15-20)41-26-14-33-28(24(16-37)34-26)35-9-5-30(6-10-35)12-21-3-2-7-31-23(21)13-30/h2-4,7-8,14,20,22,37H,5-6,9-13,15-19H2,1H3 |
| InChIKey | BCMOTAMJDUKEKE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|