C24H29N3O4S2 — CID 146478530
2-[6-[5-[2-(dimethylamino)ethoxy]-3-oxo-1,2-benzothiazol-2-yl]hexyl]-5-hydroxy-1,2-benzothiazol-3-one (PubChem CID 146478530) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-[6-[5-[2-(dimethylamino)ethoxy]-3-oxo-1,2-benzothiazol-2-yl]hexyl]-5-hydroxy-1,2-benzothiazol-3-one.
| Compound Name | 2-[6-[5-[2-(dimethylamino)ethoxy]-3-oxo-1,2-benzothiazol-2-yl]hexyl]-5-hydroxy-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 146478530 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-[6-[5-[2-(dimethylamino)ethoxy]-3-oxo-1,2-benzothiazol-2-yl]hexyl]-5-hydroxy-1,2-benzothiazol-3-one |
| SMILES | CN(C)CCOc1ccc2sn(CCCCCCn3sc4ccc(O)cc4c3=O)c(=O)c2c1 |
| InChI | InChI=1S/C24H29N3O4S2/c1-25(2)13-14-31-18-8-10-22-20(16-18)24(30)27(33-22)12-6-4-3-5-11-26-23(29)19-15-17(28)7-9-21(19)32-26/h7-10,15-16,28H,3-6,11-14H2,1-2H3 |
| InChIKey | NHUJNUKFSFMKPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|