C26H18N8O2S4 — CID 146478546
2-[5-[[3-[[[5-(3-oxo-1,2-benzothiazol-2-yl)-1,3,4-thiadiazol-2-yl]amino]methyl]phenyl]methylamino]-1,3,4-thiadiazol-2-yl]-1,2-benzothiazol-3-one (PubChem CID 146478546) has the molecular formula C26H18N8O2S4 and a molecular weight of 602.75 g/mol. Its IUPAC name is 2-[5-[[3-[[[5-(3-oxo-1,2-benzothiazol-2-yl)-1,3,4-thiadiazol-2-yl]amino]methyl]phenyl]methylamino]-1,3,4-thiadiazol-2-yl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[5-[[3-[[[5-(3-oxo-1,2-benzothiazol-2-yl)-1,3,4-thiadiazol-2-yl]amino]methyl]phenyl]methylamino]-1,3,4-thiadiazol-2-yl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 146478546 |
| Molecular Formula | C26H18N8O2S4 |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.04 |
| IUPAC Name | 2-[5-[[3-[[[5-(3-oxo-1,2-benzothiazol-2-yl)-1,3,4-thiadiazol-2-yl]amino]methyl]phenyl]methylamino]-1,3,4-thiadiazol-2-yl]-1,2-benzothiazol-3-one |
| SMILES | O=c1c2ccccc2sn1-c1nnc(NCc2cccc(CNc3nnc(-n4sc5ccccc5c4=O)s3)c2)s1 |
| InChI | InChI=1S/C26H18N8O2S4/c35-21-17-8-1-3-10-19(17)39-33(21)25-31-29-23(37-25)27-13-15-6-5-7-16(12-15)14-28-24-30-32-26(38-24)34-22(36)18-9-2-4-11-20(18)40-34/h1-12H,13-14H2,(H,27,29)(H,28,30) |
| InChIKey | AGYPEEZMEJKNKA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |