About [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone
[(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone (PubChem CID 146478729) has the molecular formula C14H26FN3O
and a molecular weight of 271.38 g/mol. Its IUPAC name is [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone |
| PubChem CID | 146478729 |
| Molecular Formula | C14H26FN3O |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone |
| SMILES | CC(C)N1[C@H](C)CN(C(=O)N2CCC(F)C2)C[C@@H]1C |
| InChI | InChI=1S/C14H26FN3O/c1-10(2)18-11(3)7-17(8-12(18)4)14(19)16-6-5-13(15)9-16/h10-13H,5-9H2,1-4H3/t11-,12+,13? |
| InChIKey | VQVZERKSGFSRIH-FUNVUKJBSA-N |
| XLogP | 1.95 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone?
The IUPAC name of [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone (CID 146478729) is [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone.
What is the SMILES notation for [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone?
The canonical SMILES for [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone is CC(C)N1[C@H](C)CN(C(=O)N2CCC(F)C2)C[C@@H]1C.
What is the InChIKey of [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone?
The InChIKey is VQVZERKSGFSRIH-FUNVUKJBSA-N. The full InChI is InChI=1S/C14H26FN3O/c1-10(2)18-11(3)7-17(8-12(18)4)14(19)16-6-5-13(15)9-16/h10-13H,5-9H2,1-4H3/t11-,12+,13?.
What are the key properties of [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone?
[(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone has a molecular weight of 271.38 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-3,5-dimethyl-4-propan-2-ylpiperazin-1-yl]-(3-fluoropyrrolidin-1-yl)methanone is sourced from PubChem (CID 146478729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).