C27H31N7O2S — CID 146478919
tert-butyl 2-[(9S)-7-[4-[3-(diaminomethylideneamino)prop-1-ynyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 146478919) has the molecular formula C27H31N7O2S and a molecular weight of 517.66 g/mol. Its IUPAC name is tert-butyl 2-[(9S)-7-[4-[3-(diaminomethylideneamino)prop-1-ynyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | tert-butyl 2-[(9S)-7-[4-[3-(diaminomethylideneamino)prop-1-ynyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 146478919 |
| Molecular Formula | C27H31N7O2S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | tert-butyl 2-[(9S)-7-[4-[3-(diaminomethylideneamino)prop-1-ynyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C#CCN=C(N)N)cc1)=N[C@@H](CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C27H31N7O2S/c1-15-16(2)37-25-22(15)23(19-11-9-18(10-12-19)8-7-13-30-26(28)29)31-20(14-21(35)36-27(4,5)6)24-33-32-17(3)34(24)25/h9-12,20H,13-14H2,1-6H3,(H4,28,29,30)/t20-/m0/s1 |
| InChIKey | FKNOBGFNZKGBPX-FQEVSTJZSA-N |
| XLogP | 3.50 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|