C22H19FN6S — CID 146478973
9-[(2-fluoro-3-pyridinyl)methyl]-4,5,13-trimethyl-7-phenyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 146478973) has the molecular formula C22H19FN6S and a molecular weight of 418.50 g/mol. Its IUPAC name is 9-[(2-fluoro-3-pyridinyl)methyl]-4,5,13-trimethyl-7-phenyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 9-[(2-fluoro-3-pyridinyl)methyl]-4,5,13-trimethyl-7-phenyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 146478973 |
| Molecular Formula | C22H19FN6S |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 9-[(2-fluoro-3-pyridinyl)methyl]-4,5,13-trimethyl-7-phenyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1sc2c(c1C)C(c1ccccc1)=NN(Cc1cccnc1F)c1nnc(C)n1-2 |
| InChI | InChI=1S/C22H19FN6S/c1-13-14(2)30-21-18(13)19(16-8-5-4-6-9-16)27-28(22-26-25-15(3)29(21)22)12-17-10-7-11-24-20(17)23/h4-11H,12H2,1-3H3 |
| InChIKey | CXZHNBWPYRPFLO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|