C30H25N5S — CID 146479181
1,1-diphenyl-N-[4-(4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]methanimine (PubChem CID 146479181) has the molecular formula C30H25N5S and a molecular weight of 487.63 g/mol. Its IUPAC name is 1,1-diphenyl-N-[4-(4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]methanimine.
| Compound Name | 1,1-diphenyl-N-[4-(4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 146479181 |
| Molecular Formula | C30H25N5S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1,1-diphenyl-N-[4-(4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]methanimine |
| SMILES | Cc1sc2c(c1C)C(c1ccc(N=C(c3ccccc3)c3ccccc3)cc1)=NCc1nnc(C)n1-2 |
| InChI | InChI=1S/C30H25N5S/c1-19-20(2)36-30-27(19)29(31-18-26-34-33-21(3)35(26)30)24-14-16-25(17-15-24)32-28(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-17H,18H2,1-3H3 |
| InChIKey | DTKFLRFXSIOGSW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|