About 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine
1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine (PubChem CID 146479327) has the molecular formula C17H20ClF2N
and a molecular weight of 311.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine |
| PubChem CID | 146479327 |
| Molecular Formula | C17H20ClF2N |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine |
| SMILES | C=C=C(C)C/N=C(\CCCC(C)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClF2N/c1-4-13(2)12-21-16(6-5-11-17(3,19)20)14-7-9-15(18)10-8-14/h7-10H,1,5-6,11-12H2,2-3H3/b21-16+ |
| InChIKey | SNVNJWPMTUIIMR-LTGZKZEYSA-N |
| XLogP | 5.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine?
The IUPAC name of 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine (CID 146479327) is 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine.
What is the SMILES notation for 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine?
The canonical SMILES for 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine is C=C=C(C)C/N=C(\CCCC(C)(F)F)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine?
The InChIKey is SNVNJWPMTUIIMR-LTGZKZEYSA-N. The full InChI is InChI=1S/C17H20ClF2N/c1-4-13(2)12-21-16(6-5-11-17(3,19)20)14-7-9-15(18)10-8-14/h7-10H,1,5-6,11-12H2,2-3H3/b21-16+.
What are the key properties of 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine?
1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine has a molecular weight of 311.80 g/mol, XLogP of 5.69, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-5,5-difluoro-N-(2-methylbuta-2,3-dienyl)hexan-1-imine is sourced from PubChem (CID 146479327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).