C26H23F3N6O — CID 146479558
[2-methyl-3-(1,2,4-triazol-4-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 146479558) has the molecular formula C26H23F3N6O and a molecular weight of 492.51 g/mol. Its IUPAC name is [2-methyl-3-(1,2,4-triazol-4-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | [2-methyl-3-(1,2,4-triazol-4-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 146479558 |
| Molecular Formula | C26H23F3N6O |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | [2-methyl-3-(1,2,4-triazol-4-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | Cc1c(C(=O)N2[C@H]3CCC[C@@H]2c2nn(C)c(-c4cc(F)c(F)c(F)c4)c2C3)cccc1-n1cnnc1 |
| InChI | InChI=1S/C26H23F3N6O/c1-14-17(6-4-7-21(14)34-12-30-31-13-34)26(36)35-16-5-3-8-22(35)24-18(11-16)25(33(2)32-24)15-9-19(27)23(29)20(28)10-15/h4,6-7,9-10,12-13,16,22H,3,5,8,11H2,1-2H3/t16-,22+/m0/s1 |
| InChIKey | SRIIFYZRDYSJHX-KSFYIVLOSA-N |
| XLogP | 4.69 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|