About (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate
(5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate (PubChem CID 146479669) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate.
Molecular Properties
| Compound Name | (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate |
| PubChem CID | 146479669 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate |
| SMILES | O=C(ON1COCc2ccccc2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C16H19NO4/c18-15-14-9-5-4-8-13(14)10-20-11-17(15)21-16(19)12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10-11H2 |
| InChIKey | AQNKYXQOJSFPHT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate?
The IUPAC name of (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate (CID 146479669) is (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate.
What is the SMILES notation for (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate?
The canonical SMILES for (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate is O=C(ON1COCc2ccccc2C1=O)C1CCCCC1.
What is the InChIKey of (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate?
The InChIKey is AQNKYXQOJSFPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c18-15-14-9-5-4-8-13(14)10-20-11-17(15)21-16(19)12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10-11H2.
What are the key properties of (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate?
(5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate has a molecular weight of 289.33 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-1,3-dihydro-2,4-benzoxazepin-4-yl) cyclohexanecarboxylate is sourced from PubChem (CID 146479669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).