About 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine
3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine (PubChem CID 146480117) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine.
Molecular Properties
| Compound Name | 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine |
| PubChem CID | 146480117 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine |
| SMILES | CC(C)(C)c1cncc(-n2cnnc2)c1 |
| InChI | InChI=1S/C11H14N4/c1-11(2,3)9-4-10(6-12-5-9)15-7-13-14-8-15/h4-8H,1-3H3 |
| InChIKey | CYGLABILBXGKLI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine?
The IUPAC name of 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine (CID 146480117) is 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine.
What is the SMILES notation for 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine?
The canonical SMILES for 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine is CC(C)(C)c1cncc(-n2cnnc2)c1.
What is the InChIKey of 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine?
The InChIKey is CYGLABILBXGKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-11(2,3)9-4-10(6-12-5-9)15-7-13-14-8-15/h4-8H,1-3H3.
What are the key properties of 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine?
3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine has a molecular weight of 202.26 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-(1,2,4-triazol-4-yl)pyridine is sourced from PubChem (CID 146480117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).