About (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine
(1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine (PubChem CID 146480160) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine |
| PubChem CID | 146480160 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine |
| SMILES | C/C=C(/C)N1C=CN=C/C1=C(/N)C(C)(C)C |
| InChI | InChI=1S/C13H21N3/c1-6-10(2)16-8-7-15-9-11(16)12(14)13(3,4)5/h6-9H,14H2,1-5H3/b10-6-,12-11- |
| InChIKey | JNEYDRYYTPKXDV-RCGVWGGBSA-N |
| XLogP | 2.98 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine?
The IUPAC name of (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine (CID 146480160) is (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine.
What is the SMILES notation for (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine?
The canonical SMILES for (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine is C/C=C(/C)N1C=CN=C/C1=C(/N)C(C)(C)C.
What is the InChIKey of (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine?
The InChIKey is JNEYDRYYTPKXDV-RCGVWGGBSA-N. The full InChI is InChI=1S/C13H21N3/c1-6-10(2)16-8-7-15-9-11(16)12(14)13(3,4)5/h6-9H,14H2,1-5H3/b10-6-,12-11-.
What are the key properties of (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine?
(1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine has a molecular weight of 219.33 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-[1-[(Z)-but-2-en-2-yl]pyrazin-2-ylidene]-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 146480160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).