C24H17F6N5O — CID 146480323
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methanone (PubChem CID 146480323) has the molecular formula C24H17F6N5O and a molecular weight of 505.42 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 146480323 |
| Molecular Formula | C24H17F6N5O |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-[2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CC[C@H]2N1C(=O)c1c(C(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C24H17F6N5O/c1-33-20(11-8-14(25)18(27)15(26)9-11)13-10-12-5-6-16(19(13)32-33)35(12)23(36)21-22(24(28,29)30)31-17-4-2-3-7-34(17)21/h2-4,7-9,12,16H,5-6,10H2,1H3/t12-,16+/m0/s1 |
| InChIKey | NIFNKYLOKUDJMA-BLLLJJGKSA-N |
| XLogP | 5.07 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|