C24H20F3N5O — CID 146480718
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-pyrazolo[1,5-a]pyridin-6-ylmethanone (PubChem CID 146480718) has the molecular formula C24H20F3N5O and a molecular weight of 451.45 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-pyrazolo[1,5-a]pyridin-6-ylmethanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-pyrazolo[1,5-a]pyridin-6-ylmethanone |
|---|---|
| PubChem CID | 146480718 |
| Molecular Formula | C24H20F3N5O |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-pyrazolo[1,5-a]pyridin-6-ylmethanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CCC[C@H]2N1C(=O)c1ccc2ccnn2c1 |
| InChI | InChI=1S/C24H20F3N5O/c1-30-23(14-9-18(25)21(27)19(26)10-14)17-11-16-3-2-4-20(22(17)29-30)32(16)24(33)13-5-6-15-7-8-28-31(15)12-13/h5-10,12,16,20H,2-4,11H2,1H3/t16-,20+/m0/s1 |
| InChIKey | PEQVVGFOFZDNOG-OXJNMPFZSA-N |
| XLogP | 4.44 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|