C23H24F3N5O — CID 146480831
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 146480831) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 146480831 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)N1[C@H]2CCC[C@@H]1c1nn(C)c(-c3cc(F)c(F)c(F)c3)c1C2 |
| InChI | InChI=1S/C23H24F3N5O/c1-11-19(12(2)29(3)27-11)23(32)31-14-6-5-7-18(31)21-15(10-14)22(30(4)28-21)13-8-16(24)20(26)17(25)9-13/h8-9,14,18H,5-7,10H2,1-4H3/t14-,18+/m0/s1 |
| InChIKey | RYWWIPWAQIZIFQ-KBXCAEBGSA-N |
| XLogP | 4.15 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|