C26H21F3N4O — CID 146480884
(6-methylquinolin-8-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone (PubChem CID 146480884) has the molecular formula C26H21F3N4O and a molecular weight of 462.48 g/mol. Its IUPAC name is (6-methylquinolin-8-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone.
| Compound Name | (6-methylquinolin-8-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 146480884 |
| Molecular Formula | C26H21F3N4O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (6-methylquinolin-8-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
| SMILES | Cc1cc(C(=O)N2[C@H]3CC[C@@H]2c2nn(C)c(-c4cc(F)c(F)c(F)c4)c2C3)c2ncccc2c1 |
| InChI | InChI=1S/C26H21F3N4O/c1-13-8-14-4-3-7-30-23(14)18(9-13)26(34)33-16-5-6-21(33)24-17(12-16)25(32(2)31-24)15-10-19(27)22(29)20(28)11-15/h3-4,7-11,16,21H,5-6,12H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | AQSFJFICDACDNK-HRAATJIYSA-N |
| XLogP | 5.26 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|