C24H19F3N4O2 — CID 146480918
(2-methyl-1,3-benzoxazol-6-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone (PubChem CID 146480918) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 146480918 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
| SMILES | Cc1nc2ccc(C(=O)N3[C@H]4CC[C@@H]3c3nn(C)c(-c5cc(F)c(F)c(F)c5)c3C4)cc2o1 |
| InChI | InChI=1S/C24H19F3N4O2/c1-11-28-18-5-3-12(9-20(18)33-11)24(32)31-14-4-6-19(31)22-15(10-14)23(30(2)29-22)13-7-16(25)21(27)17(26)8-13/h3,5,7-9,14,19H,4,6,10H2,1-2H3/t14-,19+/m0/s1 |
| InChIKey | PRCBZDOUVTWUHH-IFXJQAMLSA-N |
| XLogP | 4.86 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|