C11H15NO3 — CID 146481396
(4-methoxy-2-methyl-3-pyridinyl) 2-methylpropanoate (PubChem CID 146481396) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (4-methoxy-2-methyl-3-pyridinyl) 2-methylpropanoate.
| Compound Name | (4-methoxy-2-methyl-3-pyridinyl) 2-methylpropanoate |
|---|---|
| PubChem CID | 146481396 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (4-methoxy-2-methyl-3-pyridinyl) 2-methylpropanoate |
| SMILES | COc1ccnc(C)c1OC(=O)C(C)C |
| InChI | InChI=1S/C11H15NO3/c1-7(2)11(13)15-10-8(3)12-6-5-9(10)14-4/h5-7H,1-4H3 |
| InChIKey | QAQKLQPJNQBLKT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |