About N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine
N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine (PubChem CID 146482081) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine |
| PubChem CID | 146482081 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine |
| SMILES | C=C/C=C(/F)N(C)CN |
| InChI | InChI=1S/C6H11FN2/c1-3-4-6(7)9(2)5-8/h3-4H,1,5,8H2,2H3/b6-4- |
| InChIKey | MHVUNINERYVYLF-XQRVVYSFSA-N |
| XLogP | 0.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine?
The IUPAC name of N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine (CID 146482081) is N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine.
What is the SMILES notation for N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine?
The canonical SMILES for N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine is C=C/C=C(/F)N(C)CN.
What is the InChIKey of N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine?
The InChIKey is MHVUNINERYVYLF-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H11FN2/c1-3-4-6(7)9(2)5-8/h3-4H,1,5,8H2,2H3/b6-4-.
What are the key properties of N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine?
N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine has a molecular weight of 130.17 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1E)-1-fluorobuta-1,3-dienyl]-N'-methylmethanediamine is sourced from PubChem (CID 146482081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).