C30H29F4N5O4 — CID 146482167
8-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-5-methyl-N-[2-(trifluoromethoxy)ethyl]-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-11-carboxamide (PubChem CID 146482167) has the molecular formula C30H29F4N5O4 and a molecular weight of 599.59 g/mol. Its IUPAC name is 8-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-5-methyl-N-[2-(trifluoromethoxy)ethyl]-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-11-carboxamide.
| Compound Name | 8-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-5-methyl-N-[2-(trifluoromethoxy)ethyl]-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 146482167 |
| Molecular Formula | C30H29F4N5O4 |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 8-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-5-methyl-N-[2-(trifluoromethoxy)ethyl]-3,4,6,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaene-11-carboxamide |
| SMILES | Cc1cc(F)cc(C)c1Oc1ccc(C(C)(C)O)cc1-c1cn2c(C)nnc2c2[nH]c(C(=O)NCCOC(F)(F)F)cc12 |
| InChI | InChI=1S/C30H29F4N5O4/c1-15-10-19(31)11-16(2)26(15)43-24-7-6-18(29(4,5)41)12-20(24)22-14-39-17(3)37-38-27(39)25-21(22)13-23(36-25)28(40)35-8-9-42-30(32,33)34/h6-7,10-14,36,41H,8-9H2,1-5H3,(H,35,40) |
| InChIKey | IIEPFCUCEVNTJP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|