C17H21ClN2O2 — CID 146482262
(3E,5S)-5-[(4-chlorophenyl)methyl]-1,6-diazacyclododec-3-ene-2,7-dione (PubChem CID 146482262) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is (3E,5S)-5-[(4-chlorophenyl)methyl]-1,6-diazacyclododec-3-ene-2,7-dione.
| Compound Name | (3E,5S)-5-[(4-chlorophenyl)methyl]-1,6-diazacyclododec-3-ene-2,7-dione |
|---|---|
| PubChem CID | 146482262 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (3E,5S)-5-[(4-chlorophenyl)methyl]-1,6-diazacyclododec-3-ene-2,7-dione |
| SMILES | O=C1/C=C/[C@H](Cc2ccc(Cl)cc2)NC(=O)CCCCCN1 |
| InChI | InChI=1S/C17H21ClN2O2/c18-14-7-5-13(6-8-14)12-15-9-10-16(21)19-11-3-1-2-4-17(22)20-15/h5-10,15H,1-4,11-12H2,(H,19,21)(H,20,22)/b10-9+/t15-/m1/s1 |
| InChIKey | UDSLBCKPXSHYAT-BOLDSZDNSA-N |
| XLogP | 2.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |